C24H27FN2O3 — CID 11338840
2-methoxyethyl 3-[[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]methyl]benzoate (PubChem CID 11338840) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is 2-methoxyethyl 3-[[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]methyl]benzoate.
| Compound Name | 2-methoxyethyl 3-[[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 11338840 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2-methoxyethyl 3-[[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]methyl]benzoate |
| SMILES | COCCOC(=O)c1cccc(CN2CCC(c3c[nH]c4cc(F)ccc34)CC2)c1 |
| InChI | InChI=1S/C24H27FN2O3/c1-29-11-12-30-24(28)19-4-2-3-17(13-19)16-27-9-7-18(8-10-27)22-15-26-23-14-20(25)5-6-21(22)23/h2-6,13-15,18,26H,7-12,16H2,1H3 |
| InChIKey | VLPAEGKFXDGPOV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|