C20H22FNO2 — CID 122032608
3-[[4-(4-fluorophenyl)azepan-1-yl]methyl]benzoic acid (PubChem CID 122032608) has the molecular formula C20H22FNO2 and a molecular weight of 327.40 g/mol. Its IUPAC name is 3-[[4-(4-fluorophenyl)azepan-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[4-(4-fluorophenyl)azepan-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122032608 |
| Molecular Formula | C20H22FNO2 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3-[[4-(4-fluorophenyl)azepan-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CCCC(c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C20H22FNO2/c21-19-8-6-17(7-9-19)16-5-2-11-22(12-10-16)14-15-3-1-4-18(13-15)20(23)24/h1,3-4,6-9,13,16H,2,5,10-12,14H2,(H,23,24) |
| InChIKey | ZFTWSPWIIVLVPA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |