C19H20N2O4 — CID 122035044
3-[[3-(4-nitrophenyl)piperidin-1-yl]methyl]benzoic acid (PubChem CID 122035044) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-[[3-(4-nitrophenyl)piperidin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[3-(4-nitrophenyl)piperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122035044 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 3-[[3-(4-nitrophenyl)piperidin-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CCCC(c3ccc([N+](=O)[O-])cc3)C2)c1 |
| InChI | InChI=1S/C19H20N2O4/c22-19(23)16-4-1-3-14(11-16)12-20-10-2-5-17(13-20)15-6-8-18(9-7-15)21(24)25/h1,3-4,6-9,11,17H,2,5,10,12-13H2,(H,22,23) |
| InChIKey | PEBIEQVDCIAPAW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|