C17H20N2O2S — CID 122028920
3-[[3-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]methyl]benzoic acid (PubChem CID 122028920) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 3-[[3-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[3-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122028920 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 3-[[3-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]methyl]benzoic acid |
| SMILES | Cc1csc(C2CCCN(Cc3cccc(C(=O)O)c3)C2)n1 |
| InChI | InChI=1S/C17H20N2O2S/c1-12-11-22-16(18-12)15-6-3-7-19(10-15)9-13-4-2-5-14(8-13)17(20)21/h2,4-5,8,11,15H,3,6-7,9-10H2,1H3,(H,20,21) |
| InChIKey | LOMZFCSLRIBDQY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |