C19H23N3O2 — CID 110105906
3-[[3-[6-methyl-4-(methylamino)-2-pyridinyl]pyrrolidin-1-yl]methyl]benzoic acid (PubChem CID 110105906) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-[[3-[6-methyl-4-(methylamino)-2-pyridinyl]pyrrolidin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[3-[6-methyl-4-(methylamino)-2-pyridinyl]pyrrolidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 110105906 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 3-[[3-[6-methyl-4-(methylamino)-2-pyridinyl]pyrrolidin-1-yl]methyl]benzoic acid |
| SMILES | CNc1cc(C)nc(C2CCN(Cc3cccc(C(=O)O)c3)C2)c1 |
| InChI | InChI=1S/C19H23N3O2/c1-13-8-17(20-2)10-18(21-13)16-6-7-22(12-16)11-14-4-3-5-15(9-14)19(23)24/h3-5,8-10,16H,6-7,11-12H2,1-2H3,(H,20,21)(H,23,24) |
| InChIKey | LQUPOFMJLOXSFC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |