C22H35N3 — CID 143060234
buta-1,3-diene;ethane;3-[4-(1H-indol-3-yl)piperidin-1-yl]propan-1-amine (PubChem CID 143060234) has the molecular formula C22H35N3 and a molecular weight of 341.54 g/mol. Its IUPAC name is buta-1,3-diene;ethane;3-[4-(1H-indol-3-yl)piperidin-1-yl]propan-1-amine.
| Compound Name | buta-1,3-diene;ethane;3-[4-(1H-indol-3-yl)piperidin-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 143060234 |
| Molecular Formula | C22H35N3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | buta-1,3-diene;ethane;3-[4-(1H-indol-3-yl)piperidin-1-yl]propan-1-amine |
| SMILES | C=CC=C.CC.NCCCN1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C16H23N3.C4H6.C2H6/c17-8-3-9-19-10-6-13(7-11-19)15-12-18-16-5-2-1-4-14(15)16;1-3-4-2;1-2/h1-2,4-5,12-13,18H,3,6-11,17H2;3-4H,1-2H2;1-2H3 |
| InChIKey | BPZSWWJCSKSCSP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|