About methane;3-[1-[(4-phenylpiperidin-1-yl)methyl]piperidin-4-yl]-1H-indole
methane;3-[1-[(4-phenylpiperidin-1-yl)methyl]piperidin-4-yl]-1H-indole (PubChem CID 160789149) has the molecular formula C27H39N3
and a molecular weight of 405.63 g/mol. Its IUPAC name is methane;3-[1-[(4-phenylpiperidin-1-yl)methyl]piperidin-4-yl]-1H-indole.
Molecular Properties
| Compound Name | methane;3-[1-[(4-phenylpiperidin-1-yl)methyl]piperidin-4-yl]-1H-indole |
| PubChem CID | 160789149 |
| Molecular Formula | C27H39N3 |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.31 |
| IUPAC Name | methane;3-[1-[(4-phenylpiperidin-1-yl)methyl]piperidin-4-yl]-1H-indole |
| SMILES | C.C.c1ccc(C2CCN(CN3CCC(c4c[nH]c5ccccc45)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H31N3.2CH4/c1-2-6-20(7-3-1)21-10-14-27(15-11-21)19-28-16-12-22(13-17-28)24-18-26-25-9-5-4-8-23(24)25;;/h1-9,18,21-22,26H,10-17,19H2;2*1H4 |
| InChIKey | SBPNXVYSLIYLBU-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;3-[1-[(4-phenylpiperidin-1-yl)methyl]piperidin-4-yl]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-[1-[(4-phenylpiperidin-1-yl)methyl]piperidin-4-yl]-1H-indole?
The IUPAC name of methane;3-[1-[(4-phenylpiperidin-1-yl)methyl]piperidin-4-yl]-1H-indole (CID 160789149) is methane;3-[1-[(4-phenylpiperidin-1-yl)methyl]piperidin-4-yl]-1H-indole.
What is the SMILES notation for methane;3-[1-[(4-phenylpiperidin-1-yl)methyl]piperidin-4-yl]-1H-indole?
The canonical SMILES for methane;3-[1-[(4-phenylpiperidin-1-yl)methyl]piperidin-4-yl]-1H-indole is C.C.c1ccc(C2CCN(CN3CCC(c4c[nH]c5ccccc45)CC3)CC2)cc1.
What is the InChIKey of methane;3-[1-[(4-phenylpiperidin-1-yl)methyl]piperidin-4-yl]-1H-indole?
The InChIKey is SBPNXVYSLIYLBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31N3.2CH4/c1-2-6-20(7-3-1)21-10-14-27(15-11-21)19-28-16-12-22(13-17-28)24-18-26-25-9-5-4-8-23(24)25;;/h1-9,18,21-22,26H,10-17,19H2;2*1H4.
What are the key properties of methane;3-[1-[(4-phenylpiperidin-1-yl)methyl]piperidin-4-yl]-1H-indole?
methane;3-[1-[(4-phenylpiperidin-1-yl)methyl]piperidin-4-yl]-1H-indole has a molecular weight of 405.63 g/mol, XLogP of 6.46, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-[1-[(4-phenylpiperidin-1-yl)methyl]piperidin-4-yl]-1H-indole is sourced from PubChem (CID 160789149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).