C24H30N2S — CID 171500694
1-[4-[[4-(5-ethyl-1H-indol-3-yl)piperidin-1-yl]methyl]phenyl]ethanethiol (PubChem CID 171500694) has the molecular formula C24H30N2S and a molecular weight of 378.59 g/mol. Its IUPAC name is 1-[4-[[4-(5-ethyl-1H-indol-3-yl)piperidin-1-yl]methyl]phenyl]ethanethiol.
| Compound Name | 1-[4-[[4-(5-ethyl-1H-indol-3-yl)piperidin-1-yl]methyl]phenyl]ethanethiol |
|---|---|
| PubChem CID | 171500694 |
| Molecular Formula | C24H30N2S |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 1-[4-[[4-(5-ethyl-1H-indol-3-yl)piperidin-1-yl]methyl]phenyl]ethanethiol |
| SMILES | CCc1ccc2[nH]cc(C3CCN(Cc4ccc(C(C)S)cc4)CC3)c2c1 |
| InChI | InChI=1S/C24H30N2S/c1-3-18-6-9-24-22(14-18)23(15-25-24)21-10-12-26(13-11-21)16-19-4-7-20(8-5-19)17(2)27/h4-9,14-15,17,21,25,27H,3,10-13,16H2,1-2H3 |
| InChIKey | MBLVKNFXDKRSND-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|