C24H31N3O2S2 — CID 141164181
3-(1-ethylsulfonylpiperidin-4-yl)-5-[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]-1H-indole (PubChem CID 141164181) has the molecular formula C24H31N3O2S2 and a molecular weight of 457.67 g/mol. Its IUPAC name is 3-(1-ethylsulfonylpiperidin-4-yl)-5-[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]-1H-indole.
| Compound Name | 3-(1-ethylsulfonylpiperidin-4-yl)-5-[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]-1H-indole |
|---|---|
| PubChem CID | 141164181 |
| Molecular Formula | C24H31N3O2S2 |
| Molecular Weight | 457.67 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 3-(1-ethylsulfonylpiperidin-4-yl)-5-[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]-1H-indole |
| SMILES | CCS(=O)(=O)N1CCC(c2c[nH]c3ccc(-c4cc(CN5CCCC5)cs4)cc23)CC1 |
| InChI | InChI=1S/C24H31N3O2S2/c1-2-31(28,29)27-11-7-19(8-12-27)22-15-25-23-6-5-20(14-21(22)23)24-13-18(17-30-24)16-26-9-3-4-10-26/h5-6,13-15,17,19,25H,2-4,7-12,16H2,1H3 |
| InChIKey | PUODOBMZWDSHSZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.67 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |