C27H35N3O3S — CID 141164185
N-[[3-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]phenyl]methyl]pentanamide (PubChem CID 141164185) has the molecular formula C27H35N3O3S and a molecular weight of 481.66 g/mol. Its IUPAC name is N-[[3-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]phenyl]methyl]pentanamide.
| Compound Name | N-[[3-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 141164185 |
| Molecular Formula | C27H35N3O3S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | N-[[3-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]phenyl]methyl]pentanamide |
| SMILES | CCCCC(=O)NCc1cccc(-c2ccc3[nH]cc(C4CCN(S(=O)(=O)CC)CC4)c3c2)c1 |
| InChI | InChI=1S/C27H35N3O3S/c1-3-5-9-27(31)29-18-20-7-6-8-22(16-20)23-10-11-26-24(17-23)25(19-28-26)21-12-14-30(15-13-21)34(32,33)4-2/h6-8,10-11,16-17,19,21,28H,3-5,9,12-15,18H2,1-2H3,(H,29,31) |
| InChIKey | RYOAJKPARBJNOY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |