C31H42N4O4S — CID 66722824
3-(1-ethylsulfonylpiperidin-4-yl)-5-[3-[(octanoylamino)methyl]phenyl]-1H-indole-7-carboxamide (PubChem CID 66722824) has the molecular formula C31H42N4O4S and a molecular weight of 566.77 g/mol. Its IUPAC name is 3-(1-ethylsulfonylpiperidin-4-yl)-5-[3-[(octanoylamino)methyl]phenyl]-1H-indole-7-carboxamide.
| Compound Name | 3-(1-ethylsulfonylpiperidin-4-yl)-5-[3-[(octanoylamino)methyl]phenyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 66722824 |
| Molecular Formula | C31H42N4O4S |
| Molecular Weight | 566.77 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | 3-(1-ethylsulfonylpiperidin-4-yl)-5-[3-[(octanoylamino)methyl]phenyl]-1H-indole-7-carboxamide |
| SMILES | CCCCCCCC(=O)NCc1cccc(-c2cc(C(N)=O)c3[nH]cc(C4CCN(S(=O)(=O)CC)CC4)c3c2)c1 |
| InChI | InChI=1S/C31H42N4O4S/c1-3-5-6-7-8-12-29(36)33-20-22-10-9-11-24(17-22)25-18-26-28(21-34-30(26)27(19-25)31(32)37)23-13-15-35(16-14-23)40(38,39)4-2/h9-11,17-19,21,23,34H,3-8,12-16,20H2,1-2H3,(H2,32,37)(H,33,36) |
| InChIKey | WPUYAVZWYSMVBV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.77 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|