C26H34N4O4S — CID 59003351
3-[1-(3-methoxypropylsulfonyl)piperidin-4-yl]-5-[3-(methylaminomethyl)phenyl]-1H-indole-7-carboxamide (PubChem CID 59003351) has the molecular formula C26H34N4O4S and a molecular weight of 498.65 g/mol. Its IUPAC name is 3-[1-(3-methoxypropylsulfonyl)piperidin-4-yl]-5-[3-(methylaminomethyl)phenyl]-1H-indole-7-carboxamide.
| Compound Name | 3-[1-(3-methoxypropylsulfonyl)piperidin-4-yl]-5-[3-(methylaminomethyl)phenyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 59003351 |
| Molecular Formula | C26H34N4O4S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 3-[1-(3-methoxypropylsulfonyl)piperidin-4-yl]-5-[3-(methylaminomethyl)phenyl]-1H-indole-7-carboxamide |
| SMILES | CNCc1cccc(-c2cc(C(N)=O)c3[nH]cc(C4CCN(S(=O)(=O)CCCOC)CC4)c3c2)c1 |
| InChI | InChI=1S/C26H34N4O4S/c1-28-16-18-5-3-6-20(13-18)21-14-22-24(17-29-25(22)23(15-21)26(27)31)19-7-9-30(10-8-19)35(32,33)12-4-11-34-2/h3,5-6,13-15,17,19,28-29H,4,7-12,16H2,1-2H3,(H2,27,31) |
| InChIKey | RNEKLUJSMBDEAU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|