C32H45N5O5S — CID 68790663
3-[1-(3-methoxypropylsulfonyl)piperidin-4-yl]-5-[3-[(3-morpholin-4-ylpropylamino)methyl]phenyl]-1H-indole-7-carboxamide (PubChem CID 68790663) has the molecular formula C32H45N5O5S and a molecular weight of 611.81 g/mol. Its IUPAC name is 3-[1-(3-methoxypropylsulfonyl)piperidin-4-yl]-5-[3-[(3-morpholin-4-ylpropylamino)methyl]phenyl]-1H-indole-7-carboxamide.
| Compound Name | 3-[1-(3-methoxypropylsulfonyl)piperidin-4-yl]-5-[3-[(3-morpholin-4-ylpropylamino)methyl]phenyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 68790663 |
| Molecular Formula | C32H45N5O5S |
| Molecular Weight | 611.81 g/mol |
| Exact Mass | 611.31 |
| IUPAC Name | 3-[1-(3-methoxypropylsulfonyl)piperidin-4-yl]-5-[3-[(3-morpholin-4-ylpropylamino)methyl]phenyl]-1H-indole-7-carboxamide |
| SMILES | COCCCS(=O)(=O)N1CCC(c2c[nH]c3c(C(N)=O)cc(-c4cccc(CNCCCN5CCOCC5)c4)cc23)CC1 |
| InChI | InChI=1S/C32H45N5O5S/c1-41-15-4-18-43(39,40)37-11-7-25(8-12-37)30-23-35-31-28(30)20-27(21-29(31)32(33)38)26-6-2-5-24(19-26)22-34-9-3-10-36-13-16-42-17-14-36/h2,5-6,19-21,23,25,34-35H,3-4,7-18,22H2,1H3,(H2,33,38) |
| InChIKey | IJHFAOFJLPNGNM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 129.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.81 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|