C27H32N4O5S — CID 68791098
3-[1-[2-[[(2S)-5-oxopyrrolidin-2-yl]methoxy]ethylsulfonyl]piperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide (PubChem CID 68791098) has the molecular formula C27H32N4O5S and a molecular weight of 524.64 g/mol. Its IUPAC name is 3-[1-[2-[[(2S)-5-oxopyrrolidin-2-yl]methoxy]ethylsulfonyl]piperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide.
| Compound Name | 3-[1-[2-[[(2S)-5-oxopyrrolidin-2-yl]methoxy]ethylsulfonyl]piperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 68791098 |
| Molecular Formula | C27H32N4O5S |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 3-[1-[2-[[(2S)-5-oxopyrrolidin-2-yl]methoxy]ethylsulfonyl]piperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccccc2)cc2c(C3CCN(S(=O)(=O)CCOC[C@@H]4CCC(=O)N4)CC3)c[nH]c12 |
| InChI | InChI=1S/C27H32N4O5S/c28-27(33)23-15-20(18-4-2-1-3-5-18)14-22-24(16-29-26(22)23)19-8-10-31(11-9-19)37(34,35)13-12-36-17-21-6-7-25(32)30-21/h1-5,14-16,19,21,29H,6-13,17H2,(H2,28,33)(H,30,32)/t21-/m0/s1 |
| InChIKey | VIKROZVATDSCBX-NRFANRHFSA-N |
| XLogP | 2.74 |
| TPSA | 134.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|