C26H23F2N3O3S — CID 69144056
3-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide (PubChem CID 69144056) has the molecular formula C26H23F2N3O3S and a molecular weight of 495.55 g/mol. Its IUPAC name is 3-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide.
| Compound Name | 3-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 69144056 |
| Molecular Formula | C26H23F2N3O3S |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 3-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccccc2)cc2c(C3CCN(S(=O)(=O)c4ccc(F)cc4F)CC3)c[nH]c12 |
| InChI | InChI=1S/C26H23F2N3O3S/c27-19-6-7-24(23(28)14-19)35(33,34)31-10-8-17(9-11-31)22-15-30-25-20(22)12-18(13-21(25)26(29)32)16-4-2-1-3-5-16/h1-7,12-15,17,30H,8-11H2,(H2,29,32) |
| InChIKey | AEXVDBFBYSCTRK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |