C23H26FN3O3S — CID 11154979
3-(1-ethylsulfonylpiperidin-4-yl)-5-(4-fluoro-2-methylphenyl)-1H-indole-7-carboxamide (PubChem CID 11154979) has the molecular formula C23H26FN3O3S and a molecular weight of 443.54 g/mol. Its IUPAC name is 3-(1-ethylsulfonylpiperidin-4-yl)-5-(4-fluoro-2-methylphenyl)-1H-indole-7-carboxamide.
| Compound Name | 3-(1-ethylsulfonylpiperidin-4-yl)-5-(4-fluoro-2-methylphenyl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 11154979 |
| Molecular Formula | C23H26FN3O3S |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 3-(1-ethylsulfonylpiperidin-4-yl)-5-(4-fluoro-2-methylphenyl)-1H-indole-7-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC(c2c[nH]c3c(C(N)=O)cc(-c4ccc(F)cc4C)cc23)CC1 |
| InChI | InChI=1S/C23H26FN3O3S/c1-3-31(29,30)27-8-6-15(7-9-27)21-13-26-22-19(21)11-16(12-20(22)23(25)28)18-5-4-17(24)10-14(18)2/h4-5,10-13,15,26H,3,6-9H2,1-2H3,(H2,25,28) |
| InChIKey | DNWRYLFJGQWWSY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |