C24H28N4O4S — CID 11202185
5-(4-acetamidophenyl)-3-(1-ethylsulfonylpiperidin-4-yl)-1H-indole-7-carboxamide (PubChem CID 11202185) has the molecular formula C24H28N4O4S and a molecular weight of 468.58 g/mol. Its IUPAC name is 5-(4-acetamidophenyl)-3-(1-ethylsulfonylpiperidin-4-yl)-1H-indole-7-carboxamide.
| Compound Name | 5-(4-acetamidophenyl)-3-(1-ethylsulfonylpiperidin-4-yl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 11202185 |
| Molecular Formula | C24H28N4O4S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 5-(4-acetamidophenyl)-3-(1-ethylsulfonylpiperidin-4-yl)-1H-indole-7-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC(c2c[nH]c3c(C(N)=O)cc(-c4ccc(NC(C)=O)cc4)cc23)CC1 |
| InChI | InChI=1S/C24H28N4O4S/c1-3-33(31,32)28-10-8-17(9-11-28)22-14-26-23-20(22)12-18(13-21(23)24(25)30)16-4-6-19(7-5-16)27-15(2)29/h4-7,12-14,17,26H,3,8-11H2,1-2H3,(H2,25,30)(H,27,29) |
| InChIKey | VJGQGQQMSIQTEN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |