C25H31N3O3S — CID 143205438
3-[1-(2-ethoxyethyl-methylidene-oxo-λ6-sulfanyl)piperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide (PubChem CID 143205438) has the molecular formula C25H31N3O3S and a molecular weight of 453.61 g/mol. Its IUPAC name is 3-[1-(2-ethoxyethyl-methylidene-oxo-λ6-sulfanyl)piperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide.
| Compound Name | 3-[1-(2-ethoxyethyl-methylidene-oxo-λ6-sulfanyl)piperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 143205438 |
| Molecular Formula | C25H31N3O3S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 3-[1-(2-ethoxyethyl-methylidene-oxo-λ6-sulfanyl)piperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide |
| SMILES | C=S(=O)(CCOCC)N1CCC(c2c[nH]c3c(C(N)=O)cc(-c4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C25H31N3O3S/c1-3-31-13-14-32(2,30)28-11-9-19(10-12-28)23-17-27-24-21(23)15-20(16-22(24)25(26)29)18-7-5-4-6-8-18/h4-8,15-17,19,27H,2-3,9-14H2,1H3,(H2,26,29) |
| InChIKey | PBDFOBOPEQYMRT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|