C35H42FN5O4S — CID 68791295
3-[1-[2-[2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethoxy]ethylsulfonyl]piperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide (PubChem CID 68791295) has the molecular formula C35H42FN5O4S and a molecular weight of 647.82 g/mol. Its IUPAC name is 3-[1-[2-[2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethoxy]ethylsulfonyl]piperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide.
| Compound Name | 3-[1-[2-[2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethoxy]ethylsulfonyl]piperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 68791295 |
| Molecular Formula | C35H42FN5O4S |
| Molecular Weight | 647.82 g/mol |
| Exact Mass | 647.29 |
| IUPAC Name | 3-[1-[2-[2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethoxy]ethylsulfonyl]piperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccccc2)cc2c(C3CCN(S(=O)(=O)CCOCCN4CCN(Cc5ccc(F)cc5)CC4)CC3)c[nH]c12 |
| InChI | InChI=1S/C35H42FN5O4S/c36-30-8-6-26(7-9-30)25-40-16-14-39(15-17-40)18-19-45-20-21-46(43,44)41-12-10-28(11-13-41)33-24-38-34-31(33)22-29(23-32(34)35(37)42)27-4-2-1-3-5-27/h1-9,22-24,28,38H,10-21,25H2,(H2,37,42) |
| InChIKey | GRRYTQYWUZQUGF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.82 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|