C33H31N3O5S — CID 69145423
3-[1-[4-(2-methoxyphenoxy)phenyl]sulfonylpiperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide (PubChem CID 69145423) has the molecular formula C33H31N3O5S and a molecular weight of 581.69 g/mol. Its IUPAC name is 3-[1-[4-(2-methoxyphenoxy)phenyl]sulfonylpiperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide.
| Compound Name | 3-[1-[4-(2-methoxyphenoxy)phenyl]sulfonylpiperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 69145423 |
| Molecular Formula | C33H31N3O5S |
| Molecular Weight | 581.69 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | 3-[1-[4-(2-methoxyphenoxy)phenyl]sulfonylpiperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide |
| SMILES | COc1ccccc1Oc1ccc(S(=O)(=O)N2CCC(c3c[nH]c4c(C(N)=O)cc(-c5ccccc5)cc34)CC2)cc1 |
| InChI | InChI=1S/C33H31N3O5S/c1-40-30-9-5-6-10-31(30)41-25-11-13-26(14-12-25)42(38,39)36-17-15-23(16-18-36)29-21-35-32-27(29)19-24(20-28(32)33(34)37)22-7-3-2-4-8-22/h2-14,19-21,23,35H,15-18H2,1H3,(H2,34,37) |
| InChIKey | ZWZUAKIETXERIC-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.69 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |