C26H25Cl2N3O3S — CID 143079410
amino-[3-[1-(3,4-dichlorophenyl)sulfonylpiperidin-4-yl]-5-phenyl-1H-indol-7-yl]methanol (PubChem CID 143079410) has the molecular formula C26H25Cl2N3O3S and a molecular weight of 530.48 g/mol. Its IUPAC name is amino-[3-[1-(3,4-dichlorophenyl)sulfonylpiperidin-4-yl]-5-phenyl-1H-indol-7-yl]methanol.
| Compound Name | amino-[3-[1-(3,4-dichlorophenyl)sulfonylpiperidin-4-yl]-5-phenyl-1H-indol-7-yl]methanol |
|---|---|
| PubChem CID | 143079410 |
| Molecular Formula | C26H25Cl2N3O3S |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | amino-[3-[1-(3,4-dichlorophenyl)sulfonylpiperidin-4-yl]-5-phenyl-1H-indol-7-yl]methanol |
| SMILES | NC(O)c1cc(-c2ccccc2)cc2c(C3CCN(S(=O)(=O)c4ccc(Cl)c(Cl)c4)CC3)c[nH]c12 |
| InChI | InChI=1S/C26H25Cl2N3O3S/c27-23-7-6-19(14-24(23)28)35(33,34)31-10-8-17(9-11-31)22-15-30-25-20(22)12-18(13-21(25)26(29)32)16-4-2-1-3-5-16/h1-7,12-15,17,26,30,32H,8-11,29H2 |
| InChIKey | YFNLTTRFOPRLCW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|