C20H20Cl2N2O3S — CID 66746128
5-(3,4-dichlorophenyl)-3-(1,1-dihydroxythian-4-yl)-1H-indole-7-carboxamide (PubChem CID 66746128) has the molecular formula C20H20Cl2N2O3S and a molecular weight of 439.36 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-3-(1,1-dihydroxythian-4-yl)-1H-indole-7-carboxamide.
| Compound Name | 5-(3,4-dichlorophenyl)-3-(1,1-dihydroxythian-4-yl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 66746128 |
| Molecular Formula | C20H20Cl2N2O3S |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-3-(1,1-dihydroxythian-4-yl)-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(Cl)c(Cl)c2)cc2c(C3CCS(O)(O)CC3)c[nH]c12 |
| InChI | InChI=1S/C20H20Cl2N2O3S/c21-17-2-1-12(9-18(17)22)13-7-14-16(11-3-5-28(26,27)6-4-11)10-24-19(14)15(8-13)20(23)25/h1-2,7-11,24,26-27H,3-6H2,(H2,23,25) |
| InChIKey | TWILOVOWFIUMJP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |