C20H21FN2O3S — CID 66746181
3-(1,1-dihydroxythian-4-yl)-5-(3-fluorophenyl)-1H-indole-7-carboxamide (PubChem CID 66746181) has the molecular formula C20H21FN2O3S and a molecular weight of 388.46 g/mol. Its IUPAC name is 3-(1,1-dihydroxythian-4-yl)-5-(3-fluorophenyl)-1H-indole-7-carboxamide.
| Compound Name | 3-(1,1-dihydroxythian-4-yl)-5-(3-fluorophenyl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 66746181 |
| Molecular Formula | C20H21FN2O3S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 3-(1,1-dihydroxythian-4-yl)-5-(3-fluorophenyl)-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2cccc(F)c2)cc2c(C3CCS(O)(O)CC3)c[nH]c12 |
| InChI | InChI=1S/C20H21FN2O3S/c21-15-3-1-2-13(8-15)14-9-16-18(12-4-6-27(25,26)7-5-12)11-23-19(16)17(10-14)20(22)24/h1-3,8-12,23,25-26H,4-7H2,(H2,22,24) |
| InChIKey | RLBRHPWTAHTSJI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |