C20H18ClFN2O3S — CID 66747080
5-(3-chloro-4-fluorophenyl)-3-(1,1-dioxothian-4-yl)-1H-indole-7-carboxamide (PubChem CID 66747080) has the molecular formula C20H18ClFN2O3S and a molecular weight of 420.89 g/mol. Its IUPAC name is 5-(3-chloro-4-fluorophenyl)-3-(1,1-dioxothian-4-yl)-1H-indole-7-carboxamide.
| Compound Name | 5-(3-chloro-4-fluorophenyl)-3-(1,1-dioxothian-4-yl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 66747080 |
| Molecular Formula | C20H18ClFN2O3S |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 5-(3-chloro-4-fluorophenyl)-3-(1,1-dioxothian-4-yl)-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(F)c(Cl)c2)cc2c(C3CCS(=O)(=O)CC3)c[nH]c12 |
| InChI | InChI=1S/C20H18ClFN2O3S/c21-17-9-12(1-2-18(17)22)13-7-14-16(11-3-5-28(26,27)6-4-11)10-24-19(14)15(8-13)20(23)25/h1-2,7-11,24H,3-6H2,(H2,23,25) |
| InChIKey | FGLGRKTVZZZSMX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |