C18H18N2O3S2 — CID 66746965
3-(1,1-dioxothian-4-yl)-5-thiophen-2-yl-1H-indole-7-carboxamide (PubChem CID 66746965) has the molecular formula C18H18N2O3S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 3-(1,1-dioxothian-4-yl)-5-thiophen-2-yl-1H-indole-7-carboxamide.
| Compound Name | 3-(1,1-dioxothian-4-yl)-5-thiophen-2-yl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 66746965 |
| Molecular Formula | C18H18N2O3S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 3-(1,1-dioxothian-4-yl)-5-thiophen-2-yl-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2cccs2)cc2c(C3CCS(=O)(=O)CC3)c[nH]c12 |
| InChI | InChI=1S/C18H18N2O3S2/c19-18(21)14-9-12(16-2-1-5-24-16)8-13-15(10-20-17(13)14)11-3-6-25(22,23)7-4-11/h1-2,5,8-11,20H,3-4,6-7H2,(H2,19,21) |
| InChIKey | RWWKGOFIKQUXTH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |