C23H27N3O3S — CID 69475648
2-methylpropyl 4-(7-carbamoyl-5-thiophen-2-yl-1H-indol-3-yl)piperidine-1-carboxylate (PubChem CID 69475648) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 2-methylpropyl 4-(7-carbamoyl-5-thiophen-2-yl-1H-indol-3-yl)piperidine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-(7-carbamoyl-5-thiophen-2-yl-1H-indol-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69475648 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-methylpropyl 4-(7-carbamoyl-5-thiophen-2-yl-1H-indol-3-yl)piperidine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCC(c2c[nH]c3c(C(N)=O)cc(-c4cccs4)cc23)CC1 |
| InChI | InChI=1S/C23H27N3O3S/c1-14(2)13-29-23(28)26-7-5-15(6-8-26)19-12-25-21-17(19)10-16(11-18(21)22(24)27)20-4-3-9-30-20/h3-4,9-12,14-15,25H,5-8,13H2,1-2H3,(H2,24,27) |
| InChIKey | HCOIZUDUIINOIF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |