C25H27N3O2S2 — CID 143205379
5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-(1-thiophen-2-ylsulfinylpiperidin-4-yl)-1H-indole-7-carboxamide (PubChem CID 143205379) has the molecular formula C25H27N3O2S2 and a molecular weight of 465.64 g/mol. Its IUPAC name is 5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-(1-thiophen-2-ylsulfinylpiperidin-4-yl)-1H-indole-7-carboxamide.
| Compound Name | 5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-(1-thiophen-2-ylsulfinylpiperidin-4-yl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 143205379 |
| Molecular Formula | C25H27N3O2S2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-(1-thiophen-2-ylsulfinylpiperidin-4-yl)-1H-indole-7-carboxamide |
| SMILES | C=C/C=C\C=C(/C)c1cc(C(N)=O)c2[nH]cc(C3CCN(S(=O)c4cccs4)CC3)c2c1 |
| InChI | InChI=1S/C25H27N3O2S2/c1-3-4-5-7-17(2)19-14-20-22(16-27-24(20)21(15-19)25(26)29)18-9-11-28(12-10-18)32(30)23-8-6-13-31-23/h3-8,13-16,18,27H,1,9-12H2,2H3,(H2,26,29)/b5-4-,17-7+ |
| InChIKey | OVGPXNFKDWOXTF-WYPQZIOPSA-N |
| XLogP | 5.38 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|