C33H31N3O4S — CID 69144420
3-[1-[4-(4-methoxyphenyl)phenyl]sulfonylpiperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide (PubChem CID 69144420) has the molecular formula C33H31N3O4S and a molecular weight of 565.70 g/mol. Its IUPAC name is 3-[1-[4-(4-methoxyphenyl)phenyl]sulfonylpiperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide.
| Compound Name | 3-[1-[4-(4-methoxyphenyl)phenyl]sulfonylpiperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 69144420 |
| Molecular Formula | C33H31N3O4S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | 3-[1-[4-(4-methoxyphenyl)phenyl]sulfonylpiperidin-4-yl]-5-phenyl-1H-indole-7-carboxamide |
| SMILES | COc1ccc(-c2ccc(S(=O)(=O)N3CCC(c4c[nH]c5c(C(N)=O)cc(-c6ccccc6)cc45)CC3)cc2)cc1 |
| InChI | InChI=1S/C33H31N3O4S/c1-40-27-11-7-23(8-12-27)24-9-13-28(14-10-24)41(38,39)36-17-15-25(16-18-36)31-21-35-32-29(31)19-26(20-30(32)33(34)37)22-5-3-2-4-6-22/h2-14,19-21,25,35H,15-18H2,1H3,(H2,34,37) |
| InChIKey | WAHBJQBWRZMZHS-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |