C26H35N5OS2 — CID 143205423
3-[1-[3-(4-methylpiperazin-1-yl)propylsulfanyl]piperidin-4-yl]-5-thiophen-2-yl-1H-indole-7-carboxamide (PubChem CID 143205423) has the molecular formula C26H35N5OS2 and a molecular weight of 497.73 g/mol. Its IUPAC name is 3-[1-[3-(4-methylpiperazin-1-yl)propylsulfanyl]piperidin-4-yl]-5-thiophen-2-yl-1H-indole-7-carboxamide.
| Compound Name | 3-[1-[3-(4-methylpiperazin-1-yl)propylsulfanyl]piperidin-4-yl]-5-thiophen-2-yl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 143205423 |
| Molecular Formula | C26H35N5OS2 |
| Molecular Weight | 497.73 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 3-[1-[3-(4-methylpiperazin-1-yl)propylsulfanyl]piperidin-4-yl]-5-thiophen-2-yl-1H-indole-7-carboxamide |
| SMILES | CN1CCN(CCCSN2CCC(c3c[nH]c4c(C(N)=O)cc(-c5cccs5)cc34)CC2)CC1 |
| InChI | InChI=1S/C26H35N5OS2/c1-29-10-12-30(13-11-29)7-3-15-34-31-8-5-19(6-9-31)23-18-28-25-21(23)16-20(17-22(25)26(27)32)24-4-2-14-33-24/h2,4,14,16-19,28H,3,5-13,15H2,1H3,(H2,27,32) |
| InChIKey | KONZGYDLVNRLJK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.73 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|