C19H20N2O3S2 — CID 66747184
3-(1,1-dioxothian-4-yl)-5-(5-methylthiophen-2-yl)-1H-indole-7-carboxamide (PubChem CID 66747184) has the molecular formula C19H20N2O3S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 3-(1,1-dioxothian-4-yl)-5-(5-methylthiophen-2-yl)-1H-indole-7-carboxamide.
| Compound Name | 3-(1,1-dioxothian-4-yl)-5-(5-methylthiophen-2-yl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 66747184 |
| Molecular Formula | C19H20N2O3S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 3-(1,1-dioxothian-4-yl)-5-(5-methylthiophen-2-yl)-1H-indole-7-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(N)=O)c3[nH]cc(C4CCS(=O)(=O)CC4)c3c2)s1 |
| InChI | InChI=1S/C19H20N2O3S2/c1-11-2-3-17(25-11)13-8-14-16(12-4-6-26(23,24)7-5-12)10-21-18(14)15(9-13)19(20)22/h2-3,8-10,12,21H,4-7H2,1H3,(H2,20,22) |
| InChIKey | MCSDUGDYJBXKNK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |