C20H17F3N2O3S — CID 66746457
3-(1,1-dioxothian-4-yl)-5-(3,4,5-trifluorophenyl)-1H-indole-7-carboxamide (PubChem CID 66746457) has the molecular formula C20H17F3N2O3S and a molecular weight of 422.43 g/mol. Its IUPAC name is 3-(1,1-dioxothian-4-yl)-5-(3,4,5-trifluorophenyl)-1H-indole-7-carboxamide.
| Compound Name | 3-(1,1-dioxothian-4-yl)-5-(3,4,5-trifluorophenyl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 66746457 |
| Molecular Formula | C20H17F3N2O3S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 3-(1,1-dioxothian-4-yl)-5-(3,4,5-trifluorophenyl)-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2cc(F)c(F)c(F)c2)cc2c(C3CCS(=O)(=O)CC3)c[nH]c12 |
| InChI | InChI=1S/C20H17F3N2O3S/c21-16-7-12(8-17(22)18(16)23)11-5-13-15(10-1-3-29(27,28)4-2-10)9-25-19(13)14(6-11)20(24)26/h5-10,25H,1-4H2,(H2,24,26) |
| InChIKey | SECKPORQGKWUPW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|