C20H19FN2O3S — CID 59332691
3-(1,1-dioxothian-3-yl)-5-(4-fluorophenyl)-1H-indole-7-carboxamide (PubChem CID 59332691) has the molecular formula C20H19FN2O3S and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-(1,1-dioxothian-3-yl)-5-(4-fluorophenyl)-1H-indole-7-carboxamide.
| Compound Name | 3-(1,1-dioxothian-3-yl)-5-(4-fluorophenyl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 59332691 |
| Molecular Formula | C20H19FN2O3S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 3-(1,1-dioxothian-3-yl)-5-(4-fluorophenyl)-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(F)cc2)cc2c(C3CCCS(=O)(=O)C3)c[nH]c12 |
| InChI | InChI=1S/C20H19FN2O3S/c21-15-5-3-12(4-6-15)14-8-16-18(13-2-1-7-27(25,26)11-13)10-23-19(16)17(9-14)20(22)24/h3-6,8-10,13,23H,1-2,7,11H2,(H2,22,24) |
| InChIKey | ZEOUKAGJYBKRFO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |