About 3-(1,1-dioxothian-4-yl)-5-(1H-indazol-5-yl)-1H-indole-7-carboxamide
3-(1,1-dioxothian-4-yl)-5-(1H-indazol-5-yl)-1H-indole-7-carboxamide (PubChem CID 59332704) has the molecular formula C21H20N4O3S
and a molecular weight of 408.48 g/mol. Its IUPAC name is 3-(1,1-dioxothian-4-yl)-5-(1H-indazol-5-yl)-1H-indole-7-carboxamide.
Molecular Properties
| Compound Name | 3-(1,1-dioxothian-4-yl)-5-(1H-indazol-5-yl)-1H-indole-7-carboxamide |
| PubChem CID | 59332704 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 3-(1,1-dioxothian-4-yl)-5-(1H-indazol-5-yl)-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc3[nH]ncc3c2)cc2c(C3CCS(=O)(=O)CC3)c[nH]c12 |
| InChI | InChI=1S/C21H20N4O3S/c22-21(26)17-9-14(13-1-2-19-15(7-13)10-24-25-19)8-16-18(11-23-20(16)17)12-3-5-29(27,28)6-4-12/h1-2,7-12,23H,3-6H2,(H2,22,26)(H,24,25) |
| InChIKey | GRYZQRYXNLDRRU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,1-dioxothian-4-yl)-5-(1H-indazol-5-yl)-1H-indole-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-dioxothian-4-yl)-5-(1H-indazol-5-yl)-1H-indole-7-carboxamide?
The IUPAC name of 3-(1,1-dioxothian-4-yl)-5-(1H-indazol-5-yl)-1H-indole-7-carboxamide (CID 59332704) is 3-(1,1-dioxothian-4-yl)-5-(1H-indazol-5-yl)-1H-indole-7-carboxamide.
What is the SMILES notation for 3-(1,1-dioxothian-4-yl)-5-(1H-indazol-5-yl)-1H-indole-7-carboxamide?
The canonical SMILES for 3-(1,1-dioxothian-4-yl)-5-(1H-indazol-5-yl)-1H-indole-7-carboxamide is NC(=O)c1cc(-c2ccc3[nH]ncc3c2)cc2c(C3CCS(=O)(=O)CC3)c[nH]c12.
What is the InChIKey of 3-(1,1-dioxothian-4-yl)-5-(1H-indazol-5-yl)-1H-indole-7-carboxamide?
The InChIKey is GRYZQRYXNLDRRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O3S/c22-21(26)17-9-14(13-1-2-19-15(7-13)10-24-25-19)8-16-18(11-23-20(16)17)12-3-5-29(27,28)6-4-12/h1-2,7-12,23H,3-6H2,(H2,22,26)(H,24,25).
What are the key properties of 3-(1,1-dioxothian-4-yl)-5-(1H-indazol-5-yl)-1H-indole-7-carboxamide?
3-(1,1-dioxothian-4-yl)-5-(1H-indazol-5-yl)-1H-indole-7-carboxamide has a molecular weight of 408.48 g/mol, XLogP of 3.10, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxothian-4-yl)-5-(1H-indazol-5-yl)-1H-indole-7-carboxamide is sourced from PubChem (CID 59332704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).