About 5-bromo-3-(1,1-dihydroxythiepan-4-yl)-1H-indole-7-carboxamide
5-bromo-3-(1,1-dihydroxythiepan-4-yl)-1H-indole-7-carboxamide (PubChem CID 66746745) has the molecular formula C15H19BrN2O3S
and a molecular weight of 387.30 g/mol. Its IUPAC name is 5-bromo-3-(1,1-dihydroxythiepan-4-yl)-1H-indole-7-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-3-(1,1-dihydroxythiepan-4-yl)-1H-indole-7-carboxamide |
| PubChem CID | 66746745 |
| Molecular Formula | C15H19BrN2O3S |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 5-bromo-3-(1,1-dihydroxythiepan-4-yl)-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cc(Br)cc2c(C3CCCS(O)(O)CC3)c[nH]c12 |
| InChI | InChI=1S/C15H19BrN2O3S/c16-10-6-11-13(8-18-14(11)12(7-10)15(17)19)9-2-1-4-22(20,21)5-3-9/h6-9,18,20-21H,1-5H2,(H2,17,19) |
| InChIKey | ZDIADOPYDMDAGE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-3-(1,1-dihydroxythiepan-4-yl)-1H-indole-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(1,1-dihydroxythiepan-4-yl)-1H-indole-7-carboxamide?
The IUPAC name of 5-bromo-3-(1,1-dihydroxythiepan-4-yl)-1H-indole-7-carboxamide (CID 66746745) is 5-bromo-3-(1,1-dihydroxythiepan-4-yl)-1H-indole-7-carboxamide.
What is the SMILES notation for 5-bromo-3-(1,1-dihydroxythiepan-4-yl)-1H-indole-7-carboxamide?
The canonical SMILES for 5-bromo-3-(1,1-dihydroxythiepan-4-yl)-1H-indole-7-carboxamide is NC(=O)c1cc(Br)cc2c(C3CCCS(O)(O)CC3)c[nH]c12.
What is the InChIKey of 5-bromo-3-(1,1-dihydroxythiepan-4-yl)-1H-indole-7-carboxamide?
The InChIKey is ZDIADOPYDMDAGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19BrN2O3S/c16-10-6-11-13(8-18-14(11)12(7-10)15(17)19)9-2-1-4-22(20,21)5-3-9/h6-9,18,20-21H,1-5H2,(H2,17,19).
What are the key properties of 5-bromo-3-(1,1-dihydroxythiepan-4-yl)-1H-indole-7-carboxamide?
5-bromo-3-(1,1-dihydroxythiepan-4-yl)-1H-indole-7-carboxamide has a molecular weight of 387.30 g/mol, XLogP of 4.05, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(1,1-dihydroxythiepan-4-yl)-1H-indole-7-carboxamide is sourced from PubChem (CID 66746745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).