C16H21BrN2O3S — CID 66746085
5-bromo-3-(1,1-dihydroxy-2,6-dimethylthian-4-yl)-1H-indole-7-carboxamide (PubChem CID 66746085) has the molecular formula C16H21BrN2O3S and a molecular weight of 401.33 g/mol. Its IUPAC name is 5-bromo-3-(1,1-dihydroxy-2,6-dimethylthian-4-yl)-1H-indole-7-carboxamide.
| Compound Name | 5-bromo-3-(1,1-dihydroxy-2,6-dimethylthian-4-yl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 66746085 |
| Molecular Formula | C16H21BrN2O3S |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 5-bromo-3-(1,1-dihydroxy-2,6-dimethylthian-4-yl)-1H-indole-7-carboxamide |
| SMILES | CC1CC(c2c[nH]c3c(C(N)=O)cc(Br)cc23)CC(C)S1(O)O |
| InChI | InChI=1S/C16H21BrN2O3S/c1-8-3-10(4-9(2)23(8,21)22)14-7-19-15-12(14)5-11(17)6-13(15)16(18)20/h5-10,19,21-22H,3-4H2,1-2H3,(H2,18,20) |
| InChIKey | XLBFCYSXHCNGKV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |