About 3-(1,1-dihydroxythian-4-yl)-5-[5-(hydroxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide
3-(1,1-dihydroxythian-4-yl)-5-[5-(hydroxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide (PubChem CID 66746838) has the molecular formula C19H22N2O4S2
and a molecular weight of 406.53 g/mol. Its IUPAC name is 3-(1,1-dihydroxythian-4-yl)-5-[5-(hydroxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide.
Molecular Properties
| Compound Name | 3-(1,1-dihydroxythian-4-yl)-5-[5-(hydroxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide |
| PubChem CID | 66746838 |
| Molecular Formula | C19H22N2O4S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 3-(1,1-dihydroxythian-4-yl)-5-[5-(hydroxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2csc(CO)c2)cc2c(C3CCS(O)(O)CC3)c[nH]c12 |
| InChI | InChI=1S/C19H22N2O4S2/c20-19(23)16-7-12(13-5-14(9-22)26-10-13)6-15-17(8-21-18(15)16)11-1-3-27(24,25)4-2-11/h5-8,10-11,21-22,24-25H,1-4,9H2,(H2,20,23) |
| InChIKey | GWWZAWXFGFQPSG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1,1-dihydroxythian-4-yl)-5-[5-(hydroxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-dihydroxythian-4-yl)-5-[5-(hydroxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide?
The IUPAC name of 3-(1,1-dihydroxythian-4-yl)-5-[5-(hydroxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide (CID 66746838) is 3-(1,1-dihydroxythian-4-yl)-5-[5-(hydroxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide.
What is the SMILES notation for 3-(1,1-dihydroxythian-4-yl)-5-[5-(hydroxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide?
The canonical SMILES for 3-(1,1-dihydroxythian-4-yl)-5-[5-(hydroxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide is NC(=O)c1cc(-c2csc(CO)c2)cc2c(C3CCS(O)(O)CC3)c[nH]c12.
What is the InChIKey of 3-(1,1-dihydroxythian-4-yl)-5-[5-(hydroxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide?
The InChIKey is GWWZAWXFGFQPSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O4S2/c20-19(23)16-7-12(13-5-14(9-22)26-10-13)6-15-17(8-21-18(15)16)11-1-3-27(24,25)4-2-11/h5-8,10-11,21-22,24-25H,1-4,9H2,(H2,20,23).
What are the key properties of 3-(1,1-dihydroxythian-4-yl)-5-[5-(hydroxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide?
3-(1,1-dihydroxythian-4-yl)-5-[5-(hydroxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide has a molecular weight of 406.53 g/mol, XLogP of 4.12, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dihydroxythian-4-yl)-5-[5-(hydroxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide is sourced from PubChem (CID 66746838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).