C22H28N2O4S2 — CID 66747267
3-(1,1-dihydroxythian-4-yl)-5-[5-(propoxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide (PubChem CID 66747267) has the molecular formula C22H28N2O4S2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 3-(1,1-dihydroxythian-4-yl)-5-[5-(propoxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide.
| Compound Name | 3-(1,1-dihydroxythian-4-yl)-5-[5-(propoxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 66747267 |
| Molecular Formula | C22H28N2O4S2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 3-(1,1-dihydroxythian-4-yl)-5-[5-(propoxymethyl)thiophen-3-yl]-1H-indole-7-carboxamide |
| SMILES | CCCOCc1cc(-c2cc(C(N)=O)c3[nH]cc(C4CCS(O)(O)CC4)c3c2)cs1 |
| InChI | InChI=1S/C22H28N2O4S2/c1-2-5-28-12-17-8-16(13-29-17)15-9-18-20(14-3-6-30(26,27)7-4-14)11-24-21(18)19(10-15)22(23)25/h8-11,13-14,24,26-27H,2-7,12H2,1H3,(H2,23,25) |
| InChIKey | OTKBFWCCIPGCCL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|