C18H16Cl2N2O2S — CID 113087788
3-[1-(3,4-dichlorophenyl)sulfonylpyrrolidin-3-yl]-1H-indole (PubChem CID 113087788) has the molecular formula C18H16Cl2N2O2S and a molecular weight of 395.31 g/mol. Its IUPAC name is 3-[1-(3,4-dichlorophenyl)sulfonylpyrrolidin-3-yl]-1H-indole.
| Compound Name | 3-[1-(3,4-dichlorophenyl)sulfonylpyrrolidin-3-yl]-1H-indole |
|---|---|
| PubChem CID | 113087788 |
| Molecular Formula | C18H16Cl2N2O2S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 3-[1-(3,4-dichlorophenyl)sulfonylpyrrolidin-3-yl]-1H-indole |
| SMILES | O=S(=O)(c1ccc(Cl)c(Cl)c1)N1CCC(c2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C18H16Cl2N2O2S/c19-16-6-5-13(9-17(16)20)25(23,24)22-8-7-12(11-22)15-10-21-18-4-2-1-3-14(15)18/h1-6,9-10,12,21H,7-8,11H2 |
| InChIKey | KTRKSFMMHFFBIY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |