C15H20Cl2N2O3S — CID 68554209
4-[1-(3,4-dichlorophenyl)sulfonylpiperidin-4-yl]morpholine (PubChem CID 68554209) has the molecular formula C15H20Cl2N2O3S and a molecular weight of 379.31 g/mol. Its IUPAC name is 4-[1-(3,4-dichlorophenyl)sulfonylpiperidin-4-yl]morpholine.
| Compound Name | 4-[1-(3,4-dichlorophenyl)sulfonylpiperidin-4-yl]morpholine |
|---|---|
| PubChem CID | 68554209 |
| Molecular Formula | C15H20Cl2N2O3S |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 4-[1-(3,4-dichlorophenyl)sulfonylpiperidin-4-yl]morpholine |
| SMILES | O=S(=O)(c1ccc(Cl)c(Cl)c1)N1CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C15H20Cl2N2O3S/c16-14-2-1-13(11-15(14)17)23(20,21)19-5-3-12(4-6-19)18-7-9-22-10-8-18/h1-2,11-12H,3-10H2 |
| InChIKey | BDYRYDCRLNQRJC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |