C14H20N2O4S — CID 81265123
3-(3-morpholin-4-ylpyrrolidin-1-yl)sulfonylphenol (PubChem CID 81265123) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 3-(3-morpholin-4-ylpyrrolidin-1-yl)sulfonylphenol.
| Compound Name | 3-(3-morpholin-4-ylpyrrolidin-1-yl)sulfonylphenol |
|---|---|
| PubChem CID | 81265123 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-(3-morpholin-4-ylpyrrolidin-1-yl)sulfonylphenol |
| SMILES | O=S(=O)(c1cccc(O)c1)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C14H20N2O4S/c17-13-2-1-3-14(10-13)21(18,19)16-5-4-12(11-16)15-6-8-20-9-7-15/h1-3,10,12,17H,4-9,11H2 |
| InChIKey | CKGNKZUHNYPVMS-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |