C21H23FN2O2S — CID 113087436
3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole (PubChem CID 113087436) has the molecular formula C21H23FN2O2S and a molecular weight of 386.49 g/mol. Its IUPAC name is 3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole.
| Compound Name | 3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole |
|---|---|
| PubChem CID | 113087436 |
| Molecular Formula | C21H23FN2O2S |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(c3c[nH]c4ccc(F)cc34)CC2)cc1C |
| InChI | InChI=1S/C21H23FN2O2S/c1-14-3-5-18(11-15(14)2)27(25,26)24-9-7-16(8-10-24)20-13-23-21-6-4-17(22)12-19(20)21/h3-6,11-13,16,23H,7-10H2,1-2H3 |
| InChIKey | KUWMHCQZWMXLBC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |