About 3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole
3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole (PubChem CID 113087436) has the molecular formula C21H23FN2O2S
and a molecular weight of 386.49 g/mol. Its IUPAC name is 3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole.
Molecular Properties
| Compound Name | 3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole |
| PubChem CID | 113087436 |
| Molecular Formula | C21H23FN2O2S |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(c3c[nH]c4ccc(F)cc34)CC2)cc1C |
| InChI | InChI=1S/C21H23FN2O2S/c1-14-3-5-18(11-15(14)2)27(25,26)24-9-7-16(8-10-24)20-13-23-21-6-4-17(22)12-19(20)21/h3-6,11-13,16,23H,7-10H2,1-2H3 |
| InChIKey | KUWMHCQZWMXLBC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole?
The IUPAC name of 3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole (CID 113087436) is 3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole.
What is the SMILES notation for 3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole?
The canonical SMILES for 3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole is Cc1ccc(S(=O)(=O)N2CCC(c3c[nH]c4ccc(F)cc34)CC2)cc1C.
What is the InChIKey of 3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole?
The InChIKey is KUWMHCQZWMXLBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23FN2O2S/c1-14-3-5-18(11-15(14)2)27(25,26)24-9-7-16(8-10-24)20-13-23-21-6-4-17(22)12-19(20)21/h3-6,11-13,16,23H,7-10H2,1-2H3.
What are the key properties of 3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole?
3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole has a molecular weight of 386.49 g/mol, XLogP of 4.49, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3,4-dimethylphenyl)sulfonylpiperidin-4-yl]-5-fluoro-1H-indole is sourced from PubChem (CID 113087436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).