C18H19FN2O2S2 — CID 113087664
6-fluoro-3-[1-(5-methylthiophen-2-yl)sulfonylpiperidin-4-yl]-1H-indole (PubChem CID 113087664) has the molecular formula C18H19FN2O2S2 and a molecular weight of 378.49 g/mol. Its IUPAC name is 6-fluoro-3-[1-(5-methylthiophen-2-yl)sulfonylpiperidin-4-yl]-1H-indole.
| Compound Name | 6-fluoro-3-[1-(5-methylthiophen-2-yl)sulfonylpiperidin-4-yl]-1H-indole |
|---|---|
| PubChem CID | 113087664 |
| Molecular Formula | C18H19FN2O2S2 |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 6-fluoro-3-[1-(5-methylthiophen-2-yl)sulfonylpiperidin-4-yl]-1H-indole |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(c3c[nH]c4cc(F)ccc34)CC2)s1 |
| InChI | InChI=1S/C18H19FN2O2S2/c1-12-2-5-18(24-12)25(22,23)21-8-6-13(7-9-21)16-11-20-17-10-14(19)3-4-15(16)17/h2-5,10-11,13,20H,6-9H2,1H3 |
| InChIKey | PACHKOUADYELQY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |