C16H19F3N2OS — CID 159505276
methyl-methylidene-oxo-[4-[6-(trifluoromethyl)-1H-indol-3-yl]piperidin-1-yl]-λ6-sulfane (PubChem CID 159505276) has the molecular formula C16H19F3N2OS and a molecular weight of 344.40 g/mol. Its IUPAC name is methyl-methylidene-oxo-[4-[6-(trifluoromethyl)-1H-indol-3-yl]piperidin-1-yl]-λ6-sulfane.
| Compound Name | methyl-methylidene-oxo-[4-[6-(trifluoromethyl)-1H-indol-3-yl]piperidin-1-yl]-λ6-sulfane |
|---|---|
| PubChem CID | 159505276 |
| Molecular Formula | C16H19F3N2OS |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | methyl-methylidene-oxo-[4-[6-(trifluoromethyl)-1H-indol-3-yl]piperidin-1-yl]-λ6-sulfane |
| SMILES | C=S(C)(=O)N1CCC(c2c[nH]c3cc(C(F)(F)F)ccc23)CC1 |
| InChI | InChI=1S/C16H19F3N2OS/c1-23(2,22)21-7-5-11(6-8-21)14-10-20-15-9-12(16(17,18)19)3-4-13(14)15/h3-4,9-11,20H,1,5-8H2,2H3 |
| InChIKey | IWTHWFDITIZUQZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|