C16H23N3OS — CID 144855051
N-[[4-(1H-indol-3-yl)piperidin-1-yl]-methylidene-oxo-λ6-sulfanyl]ethanamine (PubChem CID 144855051) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is N-[[4-(1H-indol-3-yl)piperidin-1-yl]-methylidene-oxo-λ6-sulfanyl]ethanamine.
| Compound Name | N-[[4-(1H-indol-3-yl)piperidin-1-yl]-methylidene-oxo-λ6-sulfanyl]ethanamine |
|---|---|
| PubChem CID | 144855051 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | N-[[4-(1H-indol-3-yl)piperidin-1-yl]-methylidene-oxo-λ6-sulfanyl]ethanamine |
| SMILES | C=S(=O)(NCC)N1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C16H23N3OS/c1-3-18-21(2,20)19-10-8-13(9-11-19)15-12-17-16-7-5-4-6-14(15)16/h4-7,12-13,17H,2-3,8-11H2,1H3,(H,18,20) |
| InChIKey | USESWBCLTHKBTQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|