C22H26N2O3S — CID 113087165
3-[1-(4-methoxy-2,5-dimethylphenyl)sulfonylpiperidin-4-yl]-1H-indole (PubChem CID 113087165) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is 3-[1-(4-methoxy-2,5-dimethylphenyl)sulfonylpiperidin-4-yl]-1H-indole.
| Compound Name | 3-[1-(4-methoxy-2,5-dimethylphenyl)sulfonylpiperidin-4-yl]-1H-indole |
|---|---|
| PubChem CID | 113087165 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 3-[1-(4-methoxy-2,5-dimethylphenyl)sulfonylpiperidin-4-yl]-1H-indole |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CCC(c3c[nH]c4ccccc34)CC2)cc1C |
| InChI | InChI=1S/C22H26N2O3S/c1-15-13-22(16(2)12-21(15)27-3)28(25,26)24-10-8-17(9-11-24)19-14-23-20-7-5-4-6-18(19)20/h4-7,12-14,17,23H,8-11H2,1-3H3 |
| InChIKey | SZNUBWGPBUGIBX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |