C27H28N2O3S — CID 160775289
3-[(2R,4S)-1,1-dioxo-2-phenylthian-4-yl]-5-phenyl-1H-indole-7-carboxamide;methane (PubChem CID 160775289) has the molecular formula C27H28N2O3S and a molecular weight of 460.60 g/mol. Its IUPAC name is 3-[(2R,4S)-1,1-dioxo-2-phenylthian-4-yl]-5-phenyl-1H-indole-7-carboxamide;methane.
| Compound Name | 3-[(2R,4S)-1,1-dioxo-2-phenylthian-4-yl]-5-phenyl-1H-indole-7-carboxamide;methane |
|---|---|
| PubChem CID | 160775289 |
| Molecular Formula | C27H28N2O3S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 3-[(2R,4S)-1,1-dioxo-2-phenylthian-4-yl]-5-phenyl-1H-indole-7-carboxamide;methane |
| SMILES | C.NC(=O)c1cc(-c2ccccc2)cc2c([C@H]3CCS(=O)(=O)[C@@H](c4ccccc4)C3)c[nH]c12 |
| InChI | InChI=1S/C26H24N2O3S.CH4/c27-26(29)22-14-20(17-7-3-1-4-8-17)13-21-23(16-28-25(21)22)19-11-12-32(30,31)24(15-19)18-9-5-2-6-10-18;/h1-10,13-14,16,19,24,28H,11-12,15H2,(H2,27,29);1H4/t19-,24+;/m0./s1 |
| InChIKey | RZWBYBPTHIOMHQ-BROMNNCMSA-N |
| XLogP | 5.60 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |