C26H24N2O2S — CID 145483626
3-(1-oxo-2-phenylthian-4-yl)-5-phenyl-1H-indole-7-carboxamide (PubChem CID 145483626) has the molecular formula C26H24N2O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is 3-(1-oxo-2-phenylthian-4-yl)-5-phenyl-1H-indole-7-carboxamide.
| Compound Name | 3-(1-oxo-2-phenylthian-4-yl)-5-phenyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 145483626 |
| Molecular Formula | C26H24N2O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 3-(1-oxo-2-phenylthian-4-yl)-5-phenyl-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccccc2)cc2c(C3CCS(=O)C(c4ccccc4)C3)c[nH]c12 |
| InChI | InChI=1S/C26H24N2O2S/c27-26(29)22-14-20(17-7-3-1-4-8-17)13-21-23(16-28-25(21)22)19-11-12-31(30)24(15-19)18-9-5-2-6-10-18/h1-10,13-14,16,19,24,28H,11-12,15H2,(H2,27,29) |
| InChIKey | XBGUCHIMUVKKCC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |