C24H22N2O3S2 — CID 59332735
3-[(2R,4S)-1,1-dioxo-2-phenylthian-4-yl]-5-thiophen-3-yl-1H-indole-7-carboxamide (PubChem CID 59332735) has the molecular formula C24H22N2O3S2 and a molecular weight of 450.59 g/mol. Its IUPAC name is 3-[(2R,4S)-1,1-dioxo-2-phenylthian-4-yl]-5-thiophen-3-yl-1H-indole-7-carboxamide.
| Compound Name | 3-[(2R,4S)-1,1-dioxo-2-phenylthian-4-yl]-5-thiophen-3-yl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 59332735 |
| Molecular Formula | C24H22N2O3S2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 3-[(2R,4S)-1,1-dioxo-2-phenylthian-4-yl]-5-thiophen-3-yl-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccsc2)cc2c([C@H]3CCS(=O)(=O)[C@@H](c4ccccc4)C3)c[nH]c12 |
| InChI | InChI=1S/C24H22N2O3S2/c25-24(27)20-11-18(17-6-8-30-14-17)10-19-21(13-26-23(19)20)16-7-9-31(28,29)22(12-16)15-4-2-1-3-5-15/h1-6,8,10-11,13-14,16,22,26H,7,9,12H2,(H2,25,27)/t16-,22+/m0/s1 |
| InChIKey | UWQJLEUCHLCXNF-KSFYIVLOSA-N |
| XLogP | 5.03 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |