C18H18N2O3S2 — CID 59332710
3-[(1,1-dioxothiolan-3-yl)methyl]-5-thiophen-3-yl-1H-indole-7-carboxamide (PubChem CID 59332710) has the molecular formula C18H18N2O3S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)methyl]-5-thiophen-3-yl-1H-indole-7-carboxamide.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)methyl]-5-thiophen-3-yl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 59332710 |
| Molecular Formula | C18H18N2O3S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)methyl]-5-thiophen-3-yl-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccsc2)cc2c(CC3CCS(=O)(=O)C3)c[nH]c12 |
| InChI | InChI=1S/C18H18N2O3S2/c19-18(21)16-7-13(12-1-3-24-9-12)6-15-14(8-20-17(15)16)5-11-2-4-25(22,23)10-11/h1,3,6-9,11,20H,2,4-5,10H2,(H2,19,21) |
| InChIKey | GXCTXOOUWLWSSH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |