About ethanethiol;5-[3-(hydroxymethyl)phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide
ethanethiol;5-[3-(hydroxymethyl)phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide (PubChem CID 143079375) has the molecular formula C23H29N3O2S
and a molecular weight of 411.57 g/mol. Its IUPAC name is ethanethiol;5-[3-(hydroxymethyl)phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide.
Molecular Properties
| Compound Name | ethanethiol;5-[3-(hydroxymethyl)phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide |
| PubChem CID | 143079375 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | ethanethiol;5-[3-(hydroxymethyl)phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide |
| SMILES | CCS.NC(=O)c1cc(-c2cccc(CO)c2)cc2c(C3CCNCC3)c[nH]c12 |
| InChI | InChI=1S/C21H23N3O2.C2H6S/c22-21(26)18-10-16(15-3-1-2-13(8-15)12-25)9-17-19(11-24-20(17)18)14-4-6-23-7-5-14;1-2-3/h1-3,8-11,14,23-25H,4-7,12H2,(H2,22,26);3H,2H2,1H3 |
| InChIKey | AAVKASVVXJBKNK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethanethiol;5-[3-(hydroxymethyl)phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanethiol;5-[3-(hydroxymethyl)phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide?
The IUPAC name of ethanethiol;5-[3-(hydroxymethyl)phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide (CID 143079375) is ethanethiol;5-[3-(hydroxymethyl)phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide.
What is the SMILES notation for ethanethiol;5-[3-(hydroxymethyl)phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide?
The canonical SMILES for ethanethiol;5-[3-(hydroxymethyl)phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide is CCS.NC(=O)c1cc(-c2cccc(CO)c2)cc2c(C3CCNCC3)c[nH]c12.
What is the InChIKey of ethanethiol;5-[3-(hydroxymethyl)phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide?
The InChIKey is AAVKASVVXJBKNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O2.C2H6S/c22-21(26)18-10-16(15-3-1-2-13(8-15)12-25)9-17-19(11-24-20(17)18)14-4-6-23-7-5-14;1-2-3/h1-3,8-11,14,23-25H,4-7,12H2,(H2,22,26);3H,2H2,1H3.
What are the key properties of ethanethiol;5-[3-(hydroxymethyl)phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide?
ethanethiol;5-[3-(hydroxymethyl)phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide has a molecular weight of 411.57 g/mol, XLogP of 3.83, 4 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanethiol;5-[3-(hydroxymethyl)phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide is sourced from PubChem (CID 143079375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).